|
|
|
Skyrun Industrial Co., Ltd.is a supplier of
|
 |
p-Ethylphenol |
|
|
This listing includes other chemicals and chemical products supplied by Skyrun Industrial Co., Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Skyrun Industrial Co., Ltd. |
| Skyrun Industrial Co.Limited, established in 2003, a state-controlled company (By Skyrun Corp. & High Hope) in China, specializing in developing, producing and handing raw pharmaceutical material and intermediates. We have expanded a compositive entity from initially only as a small manufacturer. We have extensive knowledge of domestic and international pharmaceutical markets. Our working range can be start from small amount in research stage to big bulk for industrial production. |
|
Skyrun Industrial Co., Ltd. also offers: p-Dichlorobenzene p-Dibromo benzene p-Cymene p-Cresyl acetate p-Cresol p-Chlorophenol p-Chloromandelic acid p-Chlorocresidine p-Chlorobromobenzene p-Chlorobenzhydrol p-Bromotoluene p-Benzoyloxybenzoic acid p-Anisidine p-Anisaldehyde dimethyl acetal p-Anilinobenzenesulfonic acid p-Aminobenzoyl-L-glutamic acid p-Aminobenzamide p-Aminoazobenzene-4'-sulfonic acid p-Acetylaminobenzoic acid p-Acetanisole p-(Trifluoromethyl)benzaldehyde p-(p-Anilinoanilino)phenol p-(Methylthio)phenylacetonitrile Ozocerite Ozagrel methyl ester Ozagrel Oxytocin Oxytetracycline hydrochloride Oxytetracycline 2-hydrate Oxytetracycline Oxysophocarpine Oxyresveratrol Oxypaeoniflorin Oxymetholone Oxygen Oxyfluorfen Oxyepiberberine Oxyclozanide Oxybutynin Oxybuprocaine Oxybenzone Oxpoconazole Oxone tetrabutylammonium salt Oxonazine Oxociprofloxacin Oxobutanedioic acid Oxirane Oxiracetam Oxindole Oxidized beeswax
|
|
|
| p-Ethylphenol is offered by other companies |
BuGuCh & Partners
|
|
|
|
|
|